Lorenzolxb6210 Lorenzolxb6210

Today at 2:42 AM
Physics

Answered

What is the definition of energy in scientific terms?.

Answer :

kiara5315 kiara5315

Today at 2:47 AM

Answer:

energy, in physics, the capacity for doing work. It may exist in potential, kinetic, thermal, electrical, chemical, nuclear, or other various forms.

Answer Link

Other Questions

List four MAIN Calls to Action that are included in the report.

Why is impeachment an important part of the American political process? a.It holds high ranking officials and politicians accountable for their actions b.Impeac

Why is impeachment an important part of the American political process? a.It holds high ranking officials and politicians accountable for their actions b.Impeac

Why has Georgia become a popular location for filming? Check all that apply. Film companies are no longer satisfied with the film crews in Los Angeles and New Y

You overhear a friend saying, “Plastic is the worst thing that humans have ever invented.” In four to five sentences, explain whether you agree or disagree with

it is for 10 points. unnecessary answers are not allowed. exact answer will be brainliest

Why is potentiometer preferred to a voltmeter for measuring emf of a cell?

what are the main activities of economy?

Use Present Continuous Tense to fill the blanks 1. The baby.

1. नीचे दी गयी अभिक्रिया के संबंध में कौन सा कथन असत्य है?2Pbo(s) + c(s)-2Pb(s) + Co.g(a) सीसा अपचयित हो रहा है।(b) कार्बन डाइऑक्साइड उपचयित हो रहा है।(c)कार्बन

Which of the following is not an ingredient in paella.

Because messages can vary depending on the situation, examining the context of the communication is important. This concept is called . a. syntax b. pragmatics

6b 4r represents the total cost of the rice and beans Gabriel bought. If he returns 2 bags of beans and 1 bag of rice, the expression that represents the total

Understanding how cultural differences across and within nations affect the way business is practiced is known as literacy.

Why do the signers of the Declaration proclaim that equality of all people to be "self evident" and their rights "unalienable"? Why do they maintain that democr

Which image file format is an uncompressed raster file which may contain different depths of color depths per pixel, or may be saved in grayscale?.

Find the exact value of expression Sin(100)cos(40)-cos(100)sin(40)

Which type of procedure is used to measure the level of alcohol in the blood? a. electrophoresis b. chromatography c. immunoassay d. neutron activation analysis

2(x +5) = 2x +5 what was the mistake

If 8 = x + y and y > 0, then x is 8. Choose the relationship symbol that makes the statement true. = < >