sofiTTillobatmanna sofiTTillobatmanna

Today at 9:44 AM
Arts

Answered

A form of poetry that has neither rhyme nor meter is _____.
villanelle
sonnet
free verse

Answer :

Аноним Аноним

Today at 9:49 AM

forme of poetry that has neither rhyme nor meter is called a free verse

Answer Link

Other Questions

write a story to illustrate the saying the early bird catches the fastest web.

What does the symbol bc represent

write a story to illustrate the saying the early bird catches the fastest web.

. Complete the following to explain why the median remains the same when 12 was removed from the data set. The median remains the same because removing an extre

WILL MARK BRAINLIEST!! PLEASE HELP :(What value of y allows you to determine the x-intercept(s)? For each function, where does its graph intersect the x-axis? W

Factorise[tex]12x \times 36[/tex][tex]22y - 33z[/tex][tex]14pq + 35pqr[/tex]

How toenhance effective strong defence in court cases?

WUIU UI woras :(a) The formula of a compound represents :(i) an atom,(ii) a particle,(iii) a molecule,(iv) a combination.

Bir eğitimsel oyun yaparmısınız

How to balance (1) H2+O2------>H2O (2) NH3--------->H2 +N2 (3) Na2 SO4 + Ba(NO3)2------>BaSO4 + NaNO3 (4) Pb(NO3)2----------PbO+NO2+O2 (5) Fe2 O3 + CO -------->

I need help with this

what is 1.7 repeating as a fraction

How did David Luong, one of Duckworth's students at Lowell High School, deal with getting a bad grade on a math test?

n which ways did the king deny the colonists “Life, Liberty and the pursuit of Happiness”?

Write a story ending with the statement:we apologised to each other and reconciled in 450 worlds

Find the measure of the indicated angle.

If 308 is the n'th term of the sequence 3, 8, 13, ..., then n is equal to?

Find the measure of the indicated angle.

I need to know m 1= m 2=

How were Pratt’s goals for the Carlisle School similar to previous federal policies of removing Native American tribes from their lands and waging war against t